CAS 1303974-96-0 appears in our catalog under these names: 1-tert-Butyl 3-methyl 5-oxopiperidine-1,3-dicarboxylate, 95%, Methyl 1-Boc-5-oxo-piperidine-3-carboxylate, 1-tert-Butyl 3-methyl 5-oxopiperidine-1,3-dicarboxylate, 97%, 97%, 1-tert-Butyl 3-methyl 5-oxopiperidine-1,3-dicarboxylate, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg, 500mg, 10g.
1-O-tert-butyl 3-O-methyl 5-oxopiperidine-1,3-dicarboxylate (CAS 1303974-96-0) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-oxopiperidine-1,3-dicarboxylate. InChIKey: JLMQIJJJKPJVCE-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-oxopiperidine-1,3-dicarboxylate |
| InChIKey | JLMQIJJJKPJVCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(=O)C1)C(=O)OC |
Computed by PubChem (NCBI)