Products 13041-64-0
CAS 13041-64-0 appears in our catalog under these names: Methyl 4-methoxy-1-naphthoate, 95%, Methyl 4-methoxy-1-naphthoate, 97%, Methyl–4–methoxy–1–naphthoate, Methyl 4-methoxy-1-naphthoate, 95%+, 95%+, Methyl-4-methoxy-1-naphthoate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 100mg, 5g.
Methyl 4-methoxynaphthalene-1-carboxylate (CAS 13041-64-0) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: methyl 4-methoxynaphthalene-1-carboxylate. InChIKey: KVYMSRWVZFWKLT-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | methyl 4-methoxynaphthalene-1-carboxylate |
| InChIKey | KVYMSRWVZFWKLT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)