CAS 1152583-23-7 appears in our catalog under these names: 3-Methyl-5h,6h,7h-indeno[5,6-b]furan-2-carboxylic acid, 95%, 3-Methyl-5H,6H,7H-indeno(5,6-b)furan-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-methyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-carboxylic acid (CAS 1152583-23-7) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 3-methyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-carboxylic acid. InChIKey: GIVVPLHXRBEWET-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 3-methyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-carboxylic acid |
| InChIKey | GIVVPLHXRBEWET-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C3CCCC3=C2)C(=O)O |
Computed by PubChem (NCBI)