CAS 17295-12-4 appears in our catalog under these names: Ethyl 6-hydroxy-2-naphthoate, 95%, Ethyl 6–hydroxy–2–naphthoate, Ethyl 6-hydroxy-2-naphthoate, 95%, 95%, Ethyl 6-hydroxy-2-naphthoate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 25g, 100g.
Ethyl 6-hydroxynaphthalene-2-carboxylate (CAS 17295-12-4) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: ethyl 6-hydroxynaphthalene-2-carboxylate. InChIKey: WLJMCRWYIXLKQL-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | ethyl 6-hydroxynaphthalene-2-carboxylate |
| InChIKey | WLJMCRWYIXLKQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)