CAS 1304126-28-0 appears in our catalog under these names: rel-(2S,4S)-Methyl 4-aminotetrahydrofuran-2-carboxylate hydrochloride, 97%, 97%, (2S,4S)-Methyl 4-aminotetrahydrofuran-2-carboxylate hydrochloride, 95%, rel-(2S,4S)-Methyl 4-aminotetrahydrofuran-2-carboxylate hydrochloride, 95%, rel-(2S,4S)-Methyl 4-aminotetrahydrofuran-2-carboxylate hydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Methyl (2S,4S)-4-aminooxolane-2-carboxylate;hydrochloride (CAS 1304126-28-0) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: methyl (2S,4S)-4-aminooxolane-2-carboxylate;hydrochloride. InChIKey: RFCRJDVMXJECGI-FHAQVOQBSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | methyl (2S,4S)-4-aminooxolane-2-carboxylate;hydrochloride |
| InChIKey | RFCRJDVMXJECGI-FHAQVOQBSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CO1)N.Cl |
Computed by PubChem (NCBI)