CAS 130450-63-4 is the registry number for (2R,3S,4R,5R)-2-(Allyloxy)tetrahydro-2H-pyran-3,4,5-triol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4R,5R)-2-prop-2-enoxyoxane-3,4,5-triol (CAS 130450-63-4) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: (2R,3S,4R,5R)-2-prop-2-enoxyoxane-3,4,5-triol. InChIKey: SQPCRAFFYUVIQE-OOJXKGFFSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-prop-2-enoxyoxane-3,4,5-triol |
| InChIKey | SQPCRAFFYUVIQE-OOJXKGFFSA-N |
| SMILES | C=CCO[C@H]1[C@H]([C@@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)