CAS 157604-22-3 is the registry number for (2S,3R)-2-Hydroxy-3-isobutylsuccinic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-2-hydroxy-3-(2-methylpropyl)butanedioic acid (CAS 157604-22-3) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: (2S,3R)-2-hydroxy-3-(2-methylpropyl)butanedioic acid. InChIKey: JTQSCAHKZKQYOM-RITPCOANSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (2S,3R)-2-hydroxy-3-(2-methylpropyl)butanedioic acid |
| InChIKey | JTQSCAHKZKQYOM-RITPCOANSA-N |
| SMILES | CC(C)C[C@H]([C@@H](C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)