Products 130464-56-1
CAS 130464-56-1 appears in our catalog under these names: (+)-Pteryxin, Peucedanocoumarin II, ≥98%, ≥98%, Peucedanocoumarin II. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5 mg.
[(9S,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate (CAS 130464-56-1) is a chemical compound with the molecular formula C21H22O7 and a molecular weight of 386.4 g/mol. IUPAC name: [(9S,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate. InChIKey: LYUZYPKZQDYMEE-JZWAJAMXSA-N.
| Molecular formula | C21H22O7 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | [(9S,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | LYUZYPKZQDYMEE-JZWAJAMXSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H]1[C@@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C |
Computed by PubChem (NCBI)