CAS 13047-06-8 appears in our catalog under these names: 2–Bromobenzophenone, 2-Bromobenzophenone, >97.0%(GC), 2-Bromobenzophenone 95%, 2-Bromobenzophenone, 95%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
(2-bromophenyl)-phenylmethanone (CAS 13047-06-8) is a chemical compound with the molecular formula C13H9BrO and a molecular weight of 261.11 g/mol. IUPAC name: (2-bromophenyl)-phenylmethanone. InChIKey: ABEVIHIQUUXDMS-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | (2-bromophenyl)-phenylmethanone |
| InChIKey | ABEVIHIQUUXDMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)