CAS 90-90-4 appears in our catalog under these names: 4–Bromobenzophenone, 4-Bromobenzophenone, 4-Bromobenzophenone/ 98%, 4-Bromobenzophenone, 98% , 4-Bromobenzophenone, 97%. Offered by: GLPBio, Biosynth, Chemat, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros). Available pack sizes: 100g, 250g, 500g, 1000g, 25g, 10g, 1kg, 5kg.
(4-bromophenyl)-phenylmethanone (CAS 90-90-4) is a chemical compound with the molecular formula C13H9BrO and a molecular weight of 261.11 g/mol. IUPAC name: (4-bromophenyl)-phenylmethanone. InChIKey: KEOLYBMGRQYQTN-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | (4-bromophenyl)-phenylmethanone |
| InChIKey | KEOLYBMGRQYQTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)