CAS 400744-86-7 is the registry number for 3'-Bromo-[1,1'-biphenyl]-3-carbaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-(3-bromophenyl)benzaldehyde (CAS 400744-86-7) is a chemical compound with the molecular formula C13H9BrO and a molecular weight of 261.11 g/mol. IUPAC name: 3-(3-bromophenyl)benzaldehyde. InChIKey: KWNAGYUQQCUXKX-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | 3-(3-bromophenyl)benzaldehyde |
| InChIKey | KWNAGYUQQCUXKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)Br)C=O |
Computed by PubChem (NCBI)