Products 130507-38-9

CAS 130507-38-9 appears in our catalog under these names: 6-Fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid, 95%, 6-Fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid, 97%, 6-Fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid (CAS 130507-38-9) is a chemical compound with the molecular formula C17H12FNO2 and a molecular weight of 281.28 g/mol. IUPAC name: 6-fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid. InChIKey: STGJYFAYYQRGSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12FNO2
Molecular weight281.28 g/mol
IUPAC name6-fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid
InChIKeySTGJYFAYYQRGSQ-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C=CC(=C2)F)N=C1C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)