Products 855484-86-5

CAS 855484-86-5 is the registry number for 2-(2-Fluorophenyl)-6-methylquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-fluorophenyl)-6-methylquinoline-4-carboxylic acid (CAS 855484-86-5) is a chemical compound with the molecular formula C17H12FNO2 and a molecular weight of 281.28 g/mol. IUPAC name: 2-(2-fluorophenyl)-6-methylquinoline-4-carboxylic acid. InChIKey: PLNIUMTWCNCWPV-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12FNO2
Molecular weight281.28 g/mol
IUPAC name2-(2-fluorophenyl)-6-methylquinoline-4-carboxylic acid
InChIKeyPLNIUMTWCNCWPV-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=CC=CC=C3F

Computed by PubChem (NCBI)