CAS 327092-77-3 is the registry number for Methyl 2-(4-fluorophenyl)-4-quinolinecarboxylate. Offered by: Biosynth. Available pack sizes: 2,5g.
Methyl 2-(4-fluorophenyl)quinoline-4-carboxylate (CAS 327092-77-3) is a chemical compound with the molecular formula C17H12FNO2 and a molecular weight of 281.28 g/mol. IUPAC name: methyl 2-(4-fluorophenyl)quinoline-4-carboxylate. InChIKey: JLPCIFSCLMVANF-UHFFFAOYSA-N.
| Molecular formula | C17H12FNO2 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | methyl 2-(4-fluorophenyl)quinoline-4-carboxylate |
| InChIKey | JLPCIFSCLMVANF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC2=CC=CC=C21)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)