Products 1305208-34-7
CAS 1305208-34-7 is the registry number for 2-(2,3-Dichloropyridin-4-yl)propan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,3-dichloro-4-pyridinyl)propan-2-ol (CAS 1305208-34-7) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-(2,3-dichloro-4-pyridinyl)propan-2-ol. InChIKey: XUJWDKSCZFOVHQ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-(2,3-dichloro-4-pyridinyl)propan-2-ol |
| InChIKey | XUJWDKSCZFOVHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=NC=C1)Cl)Cl)O |
Computed by PubChem (NCBI)