CAS 1305324-34-8 is the registry number for 1-(2,3,6-Trifluorophenyl)propan-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(2,3,6-trifluorophenyl)propan-2-one (CAS 1305324-34-8) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 1-(2,3,6-trifluorophenyl)propan-2-one. InChIKey: FYLJYJAACVPMRM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 1-(2,3,6-trifluorophenyl)propan-2-one |
| InChIKey | FYLJYJAACVPMRM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=CC(=C1F)F)F |
Computed by PubChem (NCBI)