CAS 243666-17-3 is the registry number for 2',3',5'-Trifluoropropiophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
1-(2,3,5-trifluorophenyl)propan-1-one (CAS 243666-17-3) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 1-(2,3,5-trifluorophenyl)propan-1-one. InChIKey: YRTVRWLNVWBVEK-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 1-(2,3,5-trifluorophenyl)propan-1-one |
| InChIKey | YRTVRWLNVWBVEK-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC(=C1)F)F)F |
Computed by PubChem (NCBI)