Products 1305324-92-8

CAS 1305324-92-8 is the registry number for 2-(tert-Butyl)oxazolo[4,5-c]pyridine-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid (CAS 1305324-92-8) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid. InChIKey: JMBRSGBJKORISN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O3
Molecular weight220.22 g/mol
IUPAC name2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid
InChIKeyJMBRSGBJKORISN-UHFFFAOYSA-N
SMILESCC(C)(C)C1=NC2=C(O1)C(=CN=C2)C(=O)O

Computed by PubChem (NCBI)