CAS 1305324-92-8 is the registry number for 2-(tert-Butyl)oxazolo[4,5-c]pyridine-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid (CAS 1305324-92-8) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid. InChIKey: JMBRSGBJKORISN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid |
| InChIKey | JMBRSGBJKORISN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(O1)C(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)