CAS 130564-49-7 is the registry number for 1-benzyl-4-(2-nitrobenzoyl)piperazine. Offered by: Biosynth. Available pack sizes: 250mg.
(4-benzylpiperazin-1-yl)-(2-nitrophenyl)methanone (CAS 130564-49-7) is a chemical compound with the molecular formula C18H19N3O3 and a molecular weight of 325.4 g/mol. IUPAC name: (4-benzylpiperazin-1-yl)-(2-nitrophenyl)methanone. InChIKey: PQVHVXSWOVGJFL-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (4-benzylpiperazin-1-yl)-(2-nitrophenyl)methanone |
| InChIKey | PQVHVXSWOVGJFL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C(=O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)