CAS 13057-08-4 appears in our catalog under these names: Heptafluoroisopropyl acrylate, 95%, Heptafluoroisopropylacrylate, 95%, Heptafluoroisopropyl acrylate, Heptafluoroisopropyl acrylate, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 25g, 1g.
1,1,1,2,3,3,3-heptafluoropropan-2-yl prop-2-enoate (CAS 13057-08-4) is a chemical compound with the molecular formula C6H3F7O2 and a molecular weight of 240.08 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoropropan-2-yl prop-2-enoate. InChIKey: JTCVKNUSIGHJRG-UHFFFAOYSA-N.
| Molecular formula | C6H3F7O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptafluoropropan-2-yl prop-2-enoate |
| InChIKey | JTCVKNUSIGHJRG-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)