CAS 74359-06-1 appears in our catalog under these names: Hexafluoroisopropyl 2-fluoroacrylate, 95%, 2-Propenoic acid，2-fluoro-， 2，2，2-trifluoro-1-(trifluoromethyl)ethyl ester, 95%+, 95%+, Hexafluoroisopropyl 2-fluoroacrylate, 95%+. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg.
1,1,1,3,3,3-hexafluoropropan-2-yl 2-fluoroprop-2-enoate (CAS 74359-06-1) is a chemical compound with the molecular formula C6H3F7O2 and a molecular weight of 240.08 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-yl 2-fluoroprop-2-enoate. InChIKey: RNMOMNJMYZWWGF-UHFFFAOYSA-N.
| Molecular formula | C6H3F7O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-fluoroprop-2-enoate |
| InChIKey | RNMOMNJMYZWWGF-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)