CAS 243139-64-2 appears in our catalog under these names: 3-(Heptafluoroprop-2-yl)prop-2-enoic acid, 95%, 4,5,5,5-Tetrafluoro-4-(trifluoromethyl)-2-pentenoic acid, 95%, 4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pent-2-enoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 100mg.
4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid (CAS 243139-64-2) is a chemical compound with the molecular formula C6H3F7O2 and a molecular weight of 240.08 g/mol. IUPAC name: 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid. InChIKey: PRHNILJSRYVRAY-UHFFFAOYSA-N.
| Molecular formula | C6H3F7O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid |
| InChIKey | PRHNILJSRYVRAY-UHFFFAOYSA-N |
| SMILES | C(=CC(C(F)(F)F)(C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)