CAS 130634-09-2 is the registry number for 2-((3-(4-Nitrophenyl)propyl)amino)ethanol, 98%, 98%. Offered by: Chemat. Available pack sizes: 5g, 25g.
2-[3-(4-nitrophenyl)propylamino]ethanol (CAS 130634-09-2) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: 2-[3-(4-nitrophenyl)propylamino]ethanol. InChIKey: RGJQCMUPYAXGNG-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-[3-(4-nitrophenyl)propylamino]ethanol |
| InChIKey | RGJQCMUPYAXGNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCNCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)