CAS 13068-60-5 is the registry number for N-(1,3-Benzothiazol-2-yl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(1,3-benzothiazol-2-yl)benzenesulfonamide (CAS 13068-60-5) is a chemical compound with the molecular formula C13H10N2O2S2 and a molecular weight of 290.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)benzenesulfonamide. InChIKey: XOELFPSLJIQWFL-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)benzenesulfonamide |
| InChIKey | XOELFPSLJIQWFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)