CAS 924218-09-7 is the registry number for 2-((2-Methylphenyl)amino)thieno(2,3-d)(1,3)thiazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-methylanilino)thieno[2,3-d][1,3]thiazole-5-carboxylic acid (CAS 924218-09-7) is a chemical compound with the molecular formula C13H10N2O2S2 and a molecular weight of 290.4 g/mol. IUPAC name: 2-(2-methylanilino)thieno[2,3-d][1,3]thiazole-5-carboxylic acid. InChIKey: GITXYRHFPBVZCK-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2-(2-methylanilino)thieno[2,3-d][1,3]thiazole-5-carboxylic acid |
| InChIKey | GITXYRHFPBVZCK-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC2=NC3=C(S2)C=C(S3)C(=O)O |
Computed by PubChem (NCBI)