CAS 628337-09-7 appears in our catalog under these names: 2-(6-Mercapto-2-oxo-2,3,4,5-tetrahydropyridin-3-yl)-3-thioxoisoindolin-1-one, 98%, 3,6'–Dithiothalidomide. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 10mg.
2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylideneisoindol-1-one (CAS 628337-09-7) is a chemical compound with the molecular formula C13H10N2O2S2 and a molecular weight of 290.4 g/mol. IUPAC name: 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylideneisoindol-1-one. InChIKey: ZNXFEZJRALUZGZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylideneisoindol-1-one |
| InChIKey | ZNXFEZJRALUZGZ-UHFFFAOYSA-N |
| SMILES | C1CC(=S)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=S |
Computed by PubChem (NCBI)