CAS 130694-74-5 is the registry number for PBI 51. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg.
Trans-(4S,5R)-4-hydroxy-4-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,5-trimethylcyclohexan-1-one (CAS 130694-74-5) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: trans-(4S,5R)-4-hydroxy-4-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,5-trimethylcyclohexan-1-one. InChIKey: WORLVFQFRWYCAV-CWJQNXGWSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | trans-(4S,5R)-4-hydroxy-4-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,5-trimethylcyclohexan-1-one |
| InChIKey | WORLVFQFRWYCAV-CWJQNXGWSA-N |
| SMILES | C[C@@H]1CC(=O)CC([C@@]1(C#C/C(=C\CO)/C)O)(C)C |
Computed by PubChem (NCBI)