Products 130721-04-9
CAS 130721-04-9 appears in our catalog under these names: 2,3-Dimethyl 5-hydroxypyridine-2,3-dicarboxylate, 95%, 2，3–Dimethyl 5–Hydroxypyridine–2，3–Dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Dimethyl 5-hydroxypyridine-2,3-dicarboxylate (CAS 130721-04-9) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: dimethyl 5-hydroxypyridine-2,3-dicarboxylate. InChIKey: FWUNEECTUYXSOW-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | dimethyl 5-hydroxypyridine-2,3-dicarboxylate |
| InChIKey | FWUNEECTUYXSOW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)O)C(=O)OC |
Computed by PubChem (NCBI)