CAS 130762-06-0 is the registry number for Rel-benzyl (1R,3S)-3-hydroxycyclopentane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-benzyl (1R,3S)-3-hydroxycyclopentane-1-carboxylate (CAS 130762-06-0) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: cis-benzyl (1R,3S)-3-hydroxycyclopentane-1-carboxylate. InChIKey: RDUCOWDKAANTQZ-NEPJUHHUSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | cis-benzyl (1R,3S)-3-hydroxycyclopentane-1-carboxylate |
| InChIKey | RDUCOWDKAANTQZ-NEPJUHHUSA-N |
| SMILES | C1C[C@@H](C[C@@H]1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)