Products 1307857-45-9

CAS 1307857-45-9 is the registry number for 2,2-Difluoro-4-methylenepentanedioic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-4-methylidenepentanedioic acid (CAS 1307857-45-9) is a chemical compound with the molecular formula C6H6F2O4 and a molecular weight of 180.11 g/mol. IUPAC name: 2,2-difluoro-4-methylidenepentanedioic acid. InChIKey: SEJFKMHKHJIQIV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6F2O4
Molecular weight180.11 g/mol
IUPAC name2,2-difluoro-4-methylidenepentanedioic acid
InChIKeySEJFKMHKHJIQIV-UHFFFAOYSA-N
SMILESC=C(CC(C(=O)O)(F)F)C(=O)O

Computed by PubChem (NCBI)