CAS 1307857-45-9 is the registry number for 2,2-Difluoro-4-methylenepentanedioic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2,2-difluoro-4-methylidenepentanedioic acid (CAS 1307857-45-9) is a chemical compound with the molecular formula C6H6F2O4 and a molecular weight of 180.11 g/mol. IUPAC name: 2,2-difluoro-4-methylidenepentanedioic acid. InChIKey: SEJFKMHKHJIQIV-UHFFFAOYSA-N.
| Molecular formula | C6H6F2O4 |
|---|---|
| Molecular weight | 180.11 g/mol |
| IUPAC name | 2,2-difluoro-4-methylidenepentanedioic acid |
| InChIKey | SEJFKMHKHJIQIV-UHFFFAOYSA-N |
| SMILES | C=C(CC(C(=O)O)(F)F)C(=O)O |
Computed by PubChem (NCBI)