CAS 142144-42-1 is the registry number for rel-(1S,3S)-2,2-Difluoro-3-(methoxycarbonyl)cyclopropane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1S,3S)-2,2-difluoro-3-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 142144-42-1) is a chemical compound with the molecular formula C6H6F2O4 and a molecular weight of 180.11 g/mol. IUPAC name: trans-(1S,3S)-2,2-difluoro-3-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: UIKKWRFOYJLALR-HRFVKAFMSA-N.
| Molecular formula | C6H6F2O4 |
|---|---|
| Molecular weight | 180.11 g/mol |
| IUPAC name | trans-(1S,3S)-2,2-difluoro-3-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | UIKKWRFOYJLALR-HRFVKAFMSA-N |
| SMILES | COC(=O)[C@@H]1[C@H](C1(F)F)C(=O)O |
Computed by PubChem (NCBI)