CAS 827032-80-4 appears in our catalog under these names: 3,3-Difluorocyclobutane-1,1-dicarboxylic acid, 97%, 3,3-Difluorocyclobutane-1,1-dicarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
3,3-difluorocyclobutane-1,1-dicarboxylic acid (CAS 827032-80-4) is a chemical compound with the molecular formula C6H6F2O4 and a molecular weight of 180.11 g/mol. IUPAC name: 3,3-difluorocyclobutane-1,1-dicarboxylic acid. InChIKey: ZXXVJKROBCCHGL-UHFFFAOYSA-N.
| Molecular formula | C6H6F2O4 |
|---|---|
| Molecular weight | 180.11 g/mol |
| IUPAC name | 3,3-difluorocyclobutane-1,1-dicarboxylic acid |
| InChIKey | ZXXVJKROBCCHGL-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)