Products 13082-48-9
CAS 13082-48-9 appears in our catalog under these names: (1,1'–Biphenyl)–4,4'–diyl bis(2–methylacrylate), Biphenyl-4,4'-diyl Bis(2-methylacrylate), >98.0%(GC), [1,1'-Biphenyl]-4,4'-diyl bis(2-methylacrylate), 98.0%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.
[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate (CAS 13082-48-9) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: [4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate. InChIKey: HVTJQICZTQZLSK-UHFFFAOYSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | [4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
| InChIKey | HVTJQICZTQZLSK-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C(=C)C |
Computed by PubChem (NCBI)