CAS 13083-96-0 is the registry number for Silane, 1,6-hexanediylbis[trimethyl- (9CI), 95%(GC-MS),RG, 95%(GC-MS),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Trimethyl(6-trimethylsilylhexyl)silane (CAS 13083-96-0) is a chemical compound with the molecular formula C12H30Si2 and a molecular weight of 230.54 g/mol. IUPAC name: trimethyl(6-trimethylsilylhexyl)silane. InChIKey: MRYUZFHUXCUPQI-UHFFFAOYSA-N.
| Molecular formula | C12H30Si2 |
|---|---|
| Molecular weight | 230.54 g/mol |
| IUPAC name | trimethyl(6-trimethylsilylhexyl)silane |
| InChIKey | MRYUZFHUXCUPQI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCCCCC[Si](C)(C)C |
Computed by PubChem (NCBI)