Products 13083-96-0

CAS 13083-96-0 is the registry number for Silane, 1,6-hexanediylbis[trimethyl- (9CI), 95%(GC-MS),RG, 95%(GC-MS),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Trimethyl(6-trimethylsilylhexyl)silane (CAS 13083-96-0) is a chemical compound with the molecular formula C12H30Si2 and a molecular weight of 230.54 g/mol. IUPAC name: trimethyl(6-trimethylsilylhexyl)silane. InChIKey: MRYUZFHUXCUPQI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H30Si2
Molecular weight230.54 g/mol
IUPAC nametrimethyl(6-trimethylsilylhexyl)silane
InChIKeyMRYUZFHUXCUPQI-UHFFFAOYSA-N
SMILESC[Si](C)(C)CCCCCC[Si](C)(C)C

Computed by PubChem (NCBI)