CAS 1633-09-6 is the registry number for Hexaethyldisilane, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Triethyl(triethylsilyl)silane (CAS 1633-09-6) is a chemical compound with the molecular formula C12H30Si2 and a molecular weight of 230.54 g/mol. IUPAC name: triethyl(triethylsilyl)silane. InChIKey: XEJUFRSVJVTIFW-UHFFFAOYSA-N.
| Molecular formula | C12H30Si2 |
|---|---|
| Molecular weight | 230.54 g/mol |
| IUPAC name | triethyl(triethylsilyl)silane |
| InChIKey | XEJUFRSVJVTIFW-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)[Si](CC)(CC)CC |
Computed by PubChem (NCBI)