CAS 63262-93-1 is the registry number for 1,2-Di-tert-butyl-1,1,2,2-tetramethyldisilane, 99%, 99%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl-[tert-butyl(dimethyl)silyl]-dimethylsilane (CAS 63262-93-1) is a chemical compound with the molecular formula C12H30Si2 and a molecular weight of 230.54 g/mol. IUPAC name: tert-butyl-[tert-butyl(dimethyl)silyl]-dimethylsilane. InChIKey: LPRFMFOJUGMAJA-UHFFFAOYSA-N.
| Molecular formula | C12H30Si2 |
|---|---|
| Molecular weight | 230.54 g/mol |
| IUPAC name | tert-butyl-[tert-butyl(dimethyl)silyl]-dimethylsilane |
| InChIKey | LPRFMFOJUGMAJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)