Products 1308327-46-9

CAS 1308327-46-9 is the registry number for 3-Fluoro-4-(oxolan-3-ylmethoxy)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonyl chloride (CAS 1308327-46-9) is a chemical compound with the molecular formula C11H12ClFO4S and a molecular weight of 294.73 g/mol. IUPAC name: 3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonyl chloride. InChIKey: HFOTUGCDSIFJEC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClFO4S
Molecular weight294.73 g/mol
IUPAC name3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonyl chloride
InChIKeyHFOTUGCDSIFJEC-UHFFFAOYSA-N
SMILESC1COCC1COC2=C(C=C(C=C2)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)