Products 1343859-00-6

CAS 1343859-00-6 appears in our catalog under these names: 3-Fluoro-4-(oxan-4-yloxy)benzene-1-sulfonyl chloride, 98%, 3-Fluoro-4-(oxan-4-yloxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3-fluoro-4-(oxan-4-yloxy)benzenesulfonyl chloride (CAS 1343859-00-6) is a chemical compound with the molecular formula C11H12ClFO4S and a molecular weight of 294.73 g/mol. IUPAC name: 3-fluoro-4-(oxan-4-yloxy)benzenesulfonyl chloride. InChIKey: FUBKPAAYHBWCKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClFO4S
Molecular weight294.73 g/mol
IUPAC name3-fluoro-4-(oxan-4-yloxy)benzenesulfonyl chloride
InChIKeyFUBKPAAYHBWCKQ-UHFFFAOYSA-N
SMILESC1COCCC1OC2=C(C=C(C=C2)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)