CAS 1488651-42-8 is the registry number for tert-Butyl 3-(chlorosulfonyl)-4-fluorobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 3-chlorosulfonyl-4-fluorobenzoate (CAS 1488651-42-8) is a chemical compound with the molecular formula C11H12ClFO4S and a molecular weight of 294.73 g/mol. IUPAC name: tert-butyl 3-chlorosulfonyl-4-fluorobenzoate. InChIKey: AGAVAWBFEGREPR-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFO4S |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | tert-butyl 3-chlorosulfonyl-4-fluorobenzoate |
| InChIKey | AGAVAWBFEGREPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)