Products 1308631-40-4
CAS 1308631-40-4 appears in our catalog under these names: NDMC101, NDMC101, 99.91%, NDMC101, 98%. Offered by: GLPBio, TargetMol, MedChemExpress, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 200mg, 25 mg, 10 mg.
N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide (CAS 1308631-40-4) is a chemical compound with the molecular formula C13H9ClFNO2 and a molecular weight of 265.67 g/mol. IUPAC name: N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide. InChIKey: NUQWCDAXACRITO-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO2 |
|---|---|
| Molecular weight | 265.67 g/mol |
| IUPAC name | N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide |
| InChIKey | NUQWCDAXACRITO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(C=C(C=C2)Cl)F)O |
Computed by PubChem (NCBI)