Products 1551407-47-6

CAS 1551407-47-6 is the registry number for 4-(4-Chloro-2-fluorophenyl)-2-methylpyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(4-chloro-2-fluorophenyl)-2-methylpyridine-3-carboxylic acid (CAS 1551407-47-6) is a chemical compound with the molecular formula C13H9ClFNO2 and a molecular weight of 265.67 g/mol. IUPAC name: 4-(4-chloro-2-fluorophenyl)-2-methylpyridine-3-carboxylic acid. InChIKey: HVEAUNUTHOQPFG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9ClFNO2
Molecular weight265.67 g/mol
IUPAC name4-(4-chloro-2-fluorophenyl)-2-methylpyridine-3-carboxylic acid
InChIKeyHVEAUNUTHOQPFG-UHFFFAOYSA-N
SMILESCC1=NC=CC(=C1C(=O)O)C2=C(C=C(C=C2)Cl)F

Computed by PubChem (NCBI)