CAS 1457602-44-6 is the registry number for (2-Fluorophenyl)methyl 6-chloropyridine-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2-fluorophenyl)methyl 6-chloropyridine-3-carboxylate (CAS 1457602-44-6) is a chemical compound with the molecular formula C13H9ClFNO2 and a molecular weight of 265.67 g/mol. IUPAC name: (2-fluorophenyl)methyl 6-chloropyridine-3-carboxylate. InChIKey: OGFBISPXDIKKST-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO2 |
|---|---|
| Molecular weight | 265.67 g/mol |
| IUPAC name | (2-fluorophenyl)methyl 6-chloropyridine-3-carboxylate |
| InChIKey | OGFBISPXDIKKST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)C2=CN=C(C=C2)Cl)F |
Computed by PubChem (NCBI)