CAS 1308650-40-9 appears in our catalog under these names: (S)-1-(4-Iodophenyl)ethanamine hydrochloride, 95%, (S)–1–(4–Iodophenyl)ethan–1–amine hydrochloride, (1S)-1-(4-iodophenyl)ethan-1-amine hydrochloride, (S)-1-(4-Iodophenyl)ethanamine hydrochloride 95%, (S)-1-(4-Iodophenyl)ethanamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 50mg, 2,5g.
(1S)-1-(4-iodophenyl)ethanamine;hydrochloride (CAS 1308650-40-9) is a chemical compound with the molecular formula C8H11ClIN and a molecular weight of 283.54 g/mol. IUPAC name: (1S)-1-(4-iodophenyl)ethanamine;hydrochloride. InChIKey: PZYFIOFVFANOJA-RGMNGODLSA-N.
| Molecular formula | C8H11ClIN |
|---|---|
| Molecular weight | 283.54 g/mol |
| IUPAC name | (1S)-1-(4-iodophenyl)ethanamine;hydrochloride |
| InChIKey | PZYFIOFVFANOJA-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)I)N.Cl |
Computed by PubChem (NCBI)