Products 2989186-63-0
CAS 2989186-63-0 appears in our catalog under these names: (S)-1-(3-Iodophenyl)ethan-1-amine (hydrochloride), 95%, 95%, (S)-1-(3-Iodophenyl)ethan-1-amine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(3-iodophenyl)ethanamine;hydrochloride (CAS 2989186-63-0) is a chemical compound with the molecular formula C8H11ClIN and a molecular weight of 283.54 g/mol. IUPAC name: (1S)-1-(3-iodophenyl)ethanamine;hydrochloride. InChIKey: PNTLMIMBOZZHGY-RGMNGODLSA-N.
| Molecular formula | C8H11ClIN |
|---|---|
| Molecular weight | 283.54 g/mol |
| IUPAC name | (1S)-1-(3-iodophenyl)ethanamine;hydrochloride |
| InChIKey | PNTLMIMBOZZHGY-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)I)N.Cl |
Computed by PubChem (NCBI)