Products 39260-90-7

CAS 39260-90-7 is the registry number for 4-Iodo-benzeneethanamine HCl (1:1). Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg, 2000mg.

Structural formula: {0} (CAS {1})

2-(4-iodophenyl)ethanamine;hydrochloride (CAS 39260-90-7) is a chemical compound with the molecular formula C8H11ClIN and a molecular weight of 283.54 g/mol. IUPAC name: 2-(4-iodophenyl)ethanamine;hydrochloride. InChIKey: RCJUNYBPNPSJJT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClIN
Molecular weight283.54 g/mol
IUPAC name2-(4-iodophenyl)ethanamine;hydrochloride
InChIKeyRCJUNYBPNPSJJT-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCN)I.Cl

Computed by PubChem (NCBI)