Products 1308650-52-3
CAS 1308650-52-3 is the registry number for (1S,5S,6S)-2-(tert-Butoxycarbonyl)-2-azabicyclo(3.1.0)hexane-6-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(1R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS 1308650-52-3) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: YYPAAJPKVQFPKB-BWZBUEFSSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | YYPAAJPKVQFPKB-BWZBUEFSSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H]1[C@@H]2C(=O)O |
Computed by PubChem (NCBI)