CAS 130887-64-8 is the registry number for (S)-1-PHENYLBUT-3-EN-1-AMINE HCL, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-1-phenylbut-3-en-1-amine;hydrochloride (CAS 130887-64-8) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1S)-1-phenylbut-3-en-1-amine;hydrochloride. InChIKey: FRNZDHMKEKWBTM-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1S)-1-phenylbut-3-en-1-amine;hydrochloride |
| InChIKey | FRNZDHMKEKWBTM-PPHPATTJSA-N |
| SMILES | C=CC[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)