Products 1308914-87-5
CAS 1308914-87-5 appears in our catalog under these names: 2-(4-Ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(4-Ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-(4-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1308914-87-5) is a chemical compound with the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. IUPAC name: 2-(4-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FNDUPDDPCFOIBC-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-(4-ethoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FNDUPDDPCFOIBC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OCC)F |
Computed by PubChem (NCBI)