Products 1308973-59-2
CAS 1308973-59-2 is the registry number for 2-(4-Carbamoylbenzenesulfonamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(4-carbamoylphenyl)sulfonylamino]propanoic acid (CAS 1308973-59-2) is a chemical compound with the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. IUPAC name: 2-[(4-carbamoylphenyl)sulfonylamino]propanoic acid. InChIKey: MGZPCTYVXOSJPA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O5S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 2-[(4-carbamoylphenyl)sulfonylamino]propanoic acid |
| InChIKey | MGZPCTYVXOSJPA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)C(=O)N |
Computed by PubChem (NCBI)