CAS 1309040-01-4 appears in our catalog under these names: (2R)-2-(2-(Phenylsulfanyl)acetamido)propanoic acid, 95%, (2R)-2-(2-(Phenylsulfanyl)acetamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
(2R)-2-[(2-phenylsulfanylacetyl)amino]propanoic acid (CAS 1309040-01-4) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: (2R)-2-[(2-phenylsulfanylacetyl)amino]propanoic acid. InChIKey: GGQHBMGKIUWBHB-MRVPVSSYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | (2R)-2-[(2-phenylsulfanylacetyl)amino]propanoic acid |
| InChIKey | GGQHBMGKIUWBHB-MRVPVSSYSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)CSC1=CC=CC=C1 |
Computed by PubChem (NCBI)